1-(9,10-dihydroanthracene-9-carbonyloxy)propan-2-yl-diethylazanium,chloride
Modify Date: 2025-09-30 15:03:49
1-(9,10-dihydroanthracene-9-carbonyloxy)propan-2-yl-diethylazanium,chloride structure
|
Common Name | 1-(9,10-dihydroanthracene-9-carbonyloxy)propan-2-yl-diethylazanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 73791-33-0 | Molecular Weight | 373.91600 | |
| Density | N/A | Boiling Point | 454.8ºC at 760 mmHg | |
| Molecular Formula | C22H28ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.7ºC | |
| Name | 1-(9,10-dihydroanthracene-9-carbonyloxy)propan-2-yl-diethylazanium,chloride |
|---|
| Boiling Point | 454.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C22H28ClNO2 |
| Molecular Weight | 373.91600 |
| Flash Point | 140.7ºC |
| Exact Mass | 373.18100 |
| PSA | 29.54000 |
| LogP | 4.79820 |
| InChIKey | ZOVBIVDUYMEAGY-UHFFFAOYSA-N |
| SMILES | CC[NH+](CC)C(C)COC(=O)C1c2ccccc2Cc2ccccc21.[Cl-] |
|
~%
1-(9,10-dihydro... CAS#:73791-33-0 |
| Literature: Burtner; Cusic Journal of the American Chemical Society, 1943 , vol. 65, p. 1582 |
|
~%
1-(9,10-dihydro... CAS#:73791-33-0 |
| Literature: Burtner; Cusic Journal of the American Chemical Society, 1943 , vol. 65, p. 1582 |
