N-Methyl-3-(3,4,5-trimethoxyphenyl)propenamide structure
|
Common Name | N-Methyl-3-(3,4,5-trimethoxyphenyl)propenamide | ||
|---|---|---|---|---|
| CAS Number | 73790-90-6 | Molecular Weight | 251.27800 | |
| Density | 1.117g/cm3 | Boiling Point | 454.5ºC at 760 mmHg | |
| Molecular Formula | C13H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.7ºC | |
| Name | (E)-N-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 454.5ºC at 760 mmHg |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.27800 |
| Flash Point | 228.7ºC |
| Exact Mass | 251.11600 |
| PSA | 60.28000 |
| LogP | 2.31190 |
| Index of Refraction | 1.538 |
| InChIKey | IWUMZEUJTOEUIF-AATRIKPKSA-N |
| SMILES | CNC(=O)C=Cc1cc(OC)c(OC)c(OC)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Methyl-3,4,5-trimethoxy-zimtsaeureamid |
| 3.4.5-Trimethoxy-N-methylcinnamamid |
| 3,4,5-Trimethoxyzimtsaeure-N-methylamid |
| CINNAMAMIDE,N-METHYL-3,4,5-TRIMETHOXY |