dichlorozinc,diethyl-[7-(ethylamino)-8-methylphenoxazin-3-ylidene]azanium,chloride
Modify Date: 2025-11-02 02:20:53
![dichlorozinc,diethyl-[7-(ethylamino)-8-methylphenoxazin-3-ylidene]azanium,chloride Structure](https://image.chemsrc.com/caspic/403/73772-31-3.png)
dichlorozinc,diethyl-[7-(ethylamino)-8-methylphenoxazin-3-ylidene]azanium,chloride structure
|
Common Name | dichlorozinc,diethyl-[7-(ethylamino)-8-methylphenoxazin-3-ylidene]azanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 73772-31-3 | Molecular Weight | 482.15200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24Cl3N3OZn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dichlorozinc,diethyl-[7-(ethylamino)-8-methylphenoxazin-3-ylidene]azanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H24Cl3N3OZn |
|---|---|
| Molecular Weight | 482.15200 |
| Exact Mass | 479.02800 |
| PSA | 41.63000 |
| InChIKey | FMMJCWFYRNBXFH-UHFFFAOYSA-L |
| SMILES | CCNc1cc2oc3cc(=[N+](CC)CC)ccc-3nc2cc1C.Cl[Zn]Cl.[Cl-] |
| Phenoxazin-5-ium,7-(diethylamino)-3-(ethylamino)-2-methyl-,chloride,compd. with zinc chloride (ZnCl2) (1:1:) |
| Phenoxazin-5-ium,7-(diethylamino)-3-(ethylamino)-2-methyl-,chloride,compd. with zinc chloride (ZnCl2) |