2-[(E)-but-2-en-2-yl]-11-methoxy-5-methylnaphtho[2,3-h]chromene-4,7,12-trione
Modify Date: 2025-08-25 10:53:17
![2-[(E)-but-2-en-2-yl]-11-methoxy-5-methylnaphtho[2,3-h]chromene-4,7,12-trione Structure](https://image.chemsrc.com/caspic/187/73713-33-4.png)
2-[(E)-but-2-en-2-yl]-11-methoxy-5-methylnaphtho[2,3-h]chromene-4,7,12-trione structure
|
Common Name | 2-[(E)-but-2-en-2-yl]-11-methoxy-5-methylnaphtho[2,3-h]chromene-4,7,12-trione | ||
|---|---|---|---|---|
| CAS Number | 73713-33-4 | Molecular Weight | 374.38600 | |
| Density | 1.311g/cm3 | Boiling Point | 598.6ºC at 760 mmHg | |
| Molecular Formula | C23H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.3ºC | |
| Name | 2-[(E)-but-2-en-2-yl]-11-methoxy-5-methylnaphtho[2,3-h]chromene-4,7,12-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.311g/cm3 |
|---|---|
| Boiling Point | 598.6ºC at 760 mmHg |
| Molecular Formula | C23H18O5 |
| Molecular Weight | 374.38600 |
| Flash Point | 262.3ºC |
| Exact Mass | 374.11500 |
| PSA | 73.58000 |
| LogP | 4.30860 |
| Index of Refraction | 1.633 |
| InChIKey | VGLATVVTPKGFKB-VZUCSPMQSA-N |
| SMILES | CC=C(C)c1cc(=O)c2c(C)cc3c(c2o1)C(=O)c1c(OC)cccc1C3=O |
|
~92%
2-[(E)-but-2-en... CAS#:73713-33-4 |
| Literature: Hauser, Frank M.; Rhee, Richard P. Journal of Organic Chemistry, 1980 , vol. 45, # 15 p. 3061 - 3068 |
![(1'E)-5-methyl-2-(1'-methyl-1'-propenyl)-7,11,12-trimethoxy-4H-anthra[1,2-b]pyran-4-one structure](https://image.chemsrc.com/caspic/404/73713-45-8.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| O-methyl kidamycinone |
| o-Methylkidamycinon |