2-[4-(oxan-2-yloxy)cyclohexyl]oxyoxane structure
|
Common Name | 2-[4-(oxan-2-yloxy)cyclohexyl]oxyoxane | ||
|---|---|---|---|---|
| CAS Number | 736-42-5 | Molecular Weight | 284.39100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[4-(oxan-2-yloxy)cyclohexyl]oxyoxane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H28O4 |
|---|---|
| Molecular Weight | 284.39100 |
| Exact Mass | 284.19900 |
| PSA | 36.92000 |
| LogP | 3.38400 |
| InChIKey | KLSSTQJRBUZCLM-UHFFFAOYSA-N |
| SMILES | C1CCC(OC2CCC(OC3CCCCO3)CC2)OC1 |
|
~3%
2-[4-(oxan-2-yl... CAS#:736-42-5 |
| Literature: Nishiguchi, Takeshi; Kuroda, Masahumi; Saitoh, Masahiko; Nishida, Akiko; Fujisaki, Shizuo Journal of the Chemical Society, Chemical Communications, 1995 , # 24 p. 2491 - 2492 |
|
~3%
2-[4-(oxan-2-yl... CAS#:736-42-5
Detail
|
| Literature: Nishiguchi, Takeshi; Fujisaki, Shizuo; Kuroda, Masahumi; Kajisaki, Kohtaro; Saitoh, Masahiko Journal of Organic Chemistry, 1998 , vol. 63, # 23 p. 8183 - 8187 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2H-Pyran,2,2'-[1,4-cyclohexanediylbis(oxy)]bis[tetrahydro |
| 1,4-Bis-<tetrahydropyran-2-yl-oxy>-cyclohexan |