Tris(4-chlorophenyl) borate
Modify Date: 2025-08-26 19:50:20
Tris(4-chlorophenyl) borate structure
|
Common Name | Tris(4-chlorophenyl) borate | ||
|---|---|---|---|---|
| CAS Number | 7359-58-2 | Molecular Weight | 393.456 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 424.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H12BCl3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.6±28.7 °C | |
| Name | Tris(4-chlorophenyl) Borate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 424.7±45.0 °C at 760 mmHg |
| Molecular Formula | C18H12BCl3O3 |
| Molecular Weight | 393.456 |
| Flash Point | 210.6±28.7 °C |
| Exact Mass | 391.994507 |
| PSA | 27.69000 |
| LogP | 9.20 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | JOAZIIBFQMIXJM-UHFFFAOYSA-N |
| SMILES | Clc1ccc(OB(Oc2ccc(Cl)cc2)Oc2ccc(Cl)cc2)cc1 |
|
~%
Tris(4-chloroph... CAS#:7359-58-2 |
| Literature: Journal of the Chemical Society, , p. 820 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Boric acid (HBO), tris(4-chlorophenyl) ester |
| Tris(4-chlorophenyl) borate |
| Tris(p-chlorophenyl) borate |