11-acetyl-6-chlorobenzo[a]phenoxazin-5-one structure
|
Common Name | 11-acetyl-6-chlorobenzo[a]phenoxazin-5-one | ||
|---|---|---|---|---|
| CAS Number | 73397-15-6 | Molecular Weight | 323.73000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 11-acetyl-6-chlorobenzo[a]phenoxazin-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H10ClNO3 |
|---|---|
| Molecular Weight | 323.73000 |
| Exact Mass | 323.03500 |
| PSA | 60.17000 |
| LogP | 4.30200 |
| InChIKey | ONPCTXDDGZVCNE-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cccc2oc3c(Cl)c(=O)c4ccccc4c-3nc12 |
|
~76%
11-acetyl-6-chl... CAS#:73397-15-6 |
| Literature: Agarwal, Nand L.; Schaefer, Wolfram Journal of Organic Chemistry, 1980 , vol. 45, # 11 p. 2155 - 2161 |
|
~0%
11-acetyl-6-chl... CAS#:73397-15-6 |
| Literature: Agarwal, Nand L.; Schaefer, Wolfram Journal of Organic Chemistry, 1980 , vol. 45, # 25 p. 5144 - 5149 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 11-acetyl-6-chloro-5H-benzo<a>phenoxazin-5-one |
| 5H-Benzo[a]phenoxazin-5-one,11-acetyl-6-chloro |