UDP-β-D-glucose disodium
Modify Date: 2025-08-22 18:09:38
UDP-β-D-glucose disodium structure
|
Common Name | UDP-β-D-glucose disodium | ||
|---|---|---|---|---|
| CAS Number | 7333-33-7 | Molecular Weight | 610.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22N2Na2O17P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of UDP-β-D-glucose disodiumUDP-β-D-glucose disodium is a the stereoisomer of UDP-α-D-glucose. UDP-β-D-glucose disodium is an oligosaccharide that can be used to synthesize glycoproteins and glycolipids. UDP-β-D-glucose disodium can be used as a substrate[1]. |
| Name | Uridine, diphosphoglucose disodium salt |
|---|---|
| Synonym | More Synonyms |
| Description | UDP-β-D-glucose disodium is a the stereoisomer of UDP-α-D-glucose. UDP-β-D-glucose disodium is an oligosaccharide that can be used to synthesize glycoproteins and glycolipids. UDP-β-D-glucose disodium can be used as a substrate[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H22N2Na2O17P2 |
|---|---|
| Molecular Weight | 610.27 |
| Exact Mass | 589.04500 |
| PSA | 316.61000 |
| InChIKey | DUAFLAJOJQGVNQ-UHFFFAOYSA-N |
| SMILES | O=c1ccn(C2OC(COP(=O)(O)OP(=O)(O)OC3OC(CO)C(O)C(O)C3O)C(O)C2O)c(=O)[nH]1.[Na+] |
| Storage condition | 2-8°C |
| Uridine diphospate N-acetylgalactosamine |
| uridine 5'-diphosphogalactose disodium salt |
| UDP-N-acetyl-D-galactosamine |
| UDP-galactopyranose disodium salt |
| Uridine diphosphate-N-acetylgalactosamine |