Benzonitrile, 3-[(1S,2S)-2-amino-1-[(4-chlorophenyl)methyl]propyl]- structure
|
Common Name | Benzonitrile, 3-[(1S,2S)-2-amino-1-[(4-chlorophenyl)methyl]propyl]- | ||
|---|---|---|---|---|
| CAS Number | 732982-66-0 | Molecular Weight | 284.78300 | |
| Density | 1.179g/cm3 | Boiling Point | 402.54ºC at 760 mmHg | |
| Molecular Formula | C17H17ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzonitrile, 3-[(1S,2S)-2-amino-1-[(4-chlorophenyl)methyl]propyl] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 402.54ºC at 760 mmHg |
| Molecular Formula | C17H17ClN2 |
| Molecular Weight | 284.78300 |
| Exact Mass | 284.10800 |
| PSA | 49.81000 |
| LogP | 4.58548 |
| Index of Refraction | 1.603 |
| InChIKey | DUGNQLMMMIZIFR-YVEFUNNKSA-N |
| SMILES | CC(N)C(Cc1ccc(Cl)cc1)c1cccc(C#N)c1 |
|
~%
Benzonitrile, 3... CAS#:732982-66-0 |
| Literature: MERCK and CO., INC. Patent: WO2007/136607 A2, 2007 ; Location in patent: Page/Page column 58-59 ; WO 2007/136607 A2 |
| N-(1S,2S)-[3-(4-chlorophenyl)-2-(3-cyanophenyl)-1-methylpropyl]amine |
| 3-((2S,3S)-3-amino-1-(4-chlorophenyl)butan-2-yl)benzonitrile |
| 2S)-2-aMino-1-[(4-chlorophenyl)Methyl]propyl] |
| N-[3-(4-chlorophenyl)-2(S)-(3-cyanophenyl)-1(S)-methylpropyl]amine |
| N-(1S,2S)-[2-(3-cyanophenyl)-3-(4-chlorophenyl)-1-methylpropyl]amine |
| 3-[(1S |
| 3-(4-chlorophenyl)-2(S)-(3-cyanophenyl)-1(S)-methyl-propylamine |