4-[2-(2-chlorophenyl)sulfanyl-4-oxoquinazolin-3-yl]benzoic acid,piperazine
Modify Date: 2025-08-25 07:30:07
![4-[2-(2-chlorophenyl)sulfanyl-4-oxoquinazolin-3-yl]benzoic acid,piperazine Structure](https://image.chemsrc.com/caspic/478/73265-34-6.png)
4-[2-(2-chlorophenyl)sulfanyl-4-oxoquinazolin-3-yl]benzoic acid,piperazine structure
|
Common Name | 4-[2-(2-chlorophenyl)sulfanyl-4-oxoquinazolin-3-yl]benzoic acid,piperazine | ||
|---|---|---|---|---|
| CAS Number | 73265-34-6 | Molecular Weight | 903.85100 | |
| Density | N/A | Boiling Point | 632ºC at 760 mmHg | |
| Molecular Formula | C46H36Cl2N6O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336ºC | |
| Name | 4-[2-(2-chlorophenyl)sulfanyl-4-oxoquinazolin-3-yl]benzoic acid,piperazine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 632ºC at 760 mmHg |
|---|---|
| Molecular Formula | C46H36Cl2N6O6S2 |
| Molecular Weight | 903.85100 |
| Flash Point | 336ºC |
| Exact Mass | 902.15100 |
| PSA | 219.04000 |
| LogP | 9.61380 |
| InChIKey | SFPVJXYZOAQGLJ-UHFFFAOYSA-N |
| SMILES | C1CNCCN1.O=C(O)c1ccc(-n2c(Sc3ccccc3Cl)nc3ccccc3c2=O)cc1.O=C(O)c1ccc(-n2c(Sc3ccccc3Cl)nc3ccccc3c2=O)cc1 |
| Benzoic acid,4-(2-((2-chlorophenyl)thio)-4-oxo-3(4H)-quinazolinyl)-,compd. with piperazine (2:1) |
| 4-[2-(2-chlorophenyl)sulfanyl-4-oxoquinazolin-3-yl]benzoic acid |
| Piperazine 1,4-bis(4-(2-((2-chlorophenyl)thio)-4-oxo-3(4H)-quinazolinyl)benzoate) |
| 4-(2-((2-Chlorophenyl)thio)-4-oxo-3(4H)-quinazolinyl)benzoic acid compd. with piperazine (2:1) |