4-[2-(4-hydroxyphenyl)propan-2-yl]phenol,oxirane,prop-2-enoic acid structure
|
Common Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol,oxirane,prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 73263-34-0 | Molecular Weight | 344.40200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol,oxirane,prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H24O5 |
|---|---|
| Molecular Weight | 344.40200 |
| Exact Mass | 344.16200 |
| PSA | 90.29000 |
| LogP | 3.69730 |
| InChIKey | DDRIIJCXUWHIJG-UHFFFAOYSA-N |
| SMILES | C1CO1.C=CC(=O)O.CC(C)(c1ccc(O)cc1)c1ccc(O)cc1 |
| Acrylic acid,bisphenol A,ethylene oxide polymer |
| 2-Propenoic acid,polymer with 4,4'-(1-methylethylidene)bis(phenol) and oxirane |