3-(3-BROMO-3-BUTENYL)BENZOIC ACID structure
|
Common Name | 3-(3-BROMO-3-BUTENYL)BENZOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 732249-31-9 | Molecular Weight | 255.10800 | |
| Density | 1.45g/cm3 | Boiling Point | 363.1ºC at 760 mmHg | |
| Molecular Formula | C11H11BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.4ºC | |
| Name | 3-(3-bromobut-3-enyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 363.1ºC at 760 mmHg |
| Molecular Formula | C11H11BrO2 |
| Molecular Weight | 255.10800 |
| Flash Point | 173.4ºC |
| Exact Mass | 253.99400 |
| PSA | 37.30000 |
| LogP | 3.22600 |
| Index of Refraction | 1.589 |
| InChIKey | HCOWKOSNUKJOPD-UHFFFAOYSA-N |
| SMILES | C=C(Br)CCc1cccc(C(=O)O)c1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-(3-bromo-3-butenyl)benzoic acid |