4-[2-(4-hydroxyphenyl)propan-2-yl]phenol,4-methyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione,2-methyloxirane
Modify Date: 2025-08-26 11:19:46
![4-[2-(4-hydroxyphenyl)propan-2-yl]phenol,4-methyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione,2-methyloxirane Structure](https://image.chemsrc.com/caspic/174/73003-52-8.png)
4-[2-(4-hydroxyphenyl)propan-2-yl]phenol,4-methyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione,2-methyloxirane structure
|
Common Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol,4-methyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione,2-methyloxirane | ||
|---|---|---|---|---|
| CAS Number | 73003-52-8 | Molecular Weight | 452.53900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H32O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol,4-methyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione,2-methyloxirane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H32O6 |
|---|---|
| Molecular Weight | 452.53900 |
| Exact Mass | 452.22000 |
| PSA | 96.36000 |
| LogP | 4.72700 |
| InChIKey | RZRDAWHCZXZDHL-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.CC1C=CCC2C(=O)OC(=O)C12.CC1CO1 |
| 1,3-Isobenzofurandione,3a,4,7,7a-tetrahydro-4-methyl-,polymer with 4,4'-(1-methylethylidene)bis(phenol) and 2-methyloxirane |
| 3-Methyl-1,2,3,6-tetrahydrophthalic anhydride,bisphenol A,propylene oxide polymer |
| 1,3-Isobenzofurandione,3a,4,7,7a-tetrahydro-4-methyl-,polymer with 4,4'-(1-methylethylidene)bis(phenol) and methyloxirane |