2-(4-tert-butylbenzoyl)cyclohexane-1-carboxylic acid,cyclohexane
Modify Date: 2025-09-24 18:58:04
2-(4-tert-butylbenzoyl)cyclohexane-1-carboxylic acid,cyclohexane structure
|
Common Name | 2-(4-tert-butylbenzoyl)cyclohexane-1-carboxylic acid,cyclohexane | ||
|---|---|---|---|---|
| CAS Number | 72987-30-5 | Molecular Weight | 660.92200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H60O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-tert-butylbenzoyl)cyclohexane-1-carboxylic acid,cyclohexane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C42H60O6 |
|---|---|
| Molecular Weight | 660.92200 |
| Exact Mass | 660.43900 |
| PSA | 108.74000 |
| LogP | 10.45620 |
| InChIKey | CMSFUFCGRAFKSD-UHFFFAOYSA-N |
| SMILES | C1CCCCC1.CC(C)(C)c1ccc(C(=O)C2CCCCC2C(=O)O)cc1.CC(C)(C)c1ccc(C(=O)C2CCCCC2C(=O)O)cc1 |
| Cyclohexanecarboxylic acid,2-(4-(1,1-dimethylethyl)benzoyl)-,compd. with cyclohexane (2:1) |
| Cyclohexanecarboxylic acid,2-(p-tert-butylbenzoyl)-,compd. with cyclohexane (2:1) |