8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione
Modify Date: 2025-09-13 20:58:00
8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione structure
|
Common Name | 8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione | ||
|---|---|---|---|---|
| CAS Number | 72985-51-4 | Molecular Weight | 207.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9NO4 |
|---|---|
| Molecular Weight | 207.18 |
| InChIKey | KCCCYZCHTJDJMY-UHFFFAOYSA-N |
| SMILES | COc1ccc(C)c2c(=O)oc(=O)[nH]c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione? |
| A: Molecular formula of 8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione is C10H9NO4. |
| Q: What is the English name of 8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione? |
| A: The English name of 8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione is 8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione. |
| Q: What is the CAS number of 8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione? |
| A: CAS number of 8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione is 72985-51-4. |
| Q: What is the molecular weight of 8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione? |
| A: Molecular weight of 8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione is 207.18. |
| Q: What is the SMILES notation of 8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione? |
| A: SMILES notation of 8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione is COc1ccc(C)c2c(=O)oc(=O)[nH]c12. |
| Q: What is the Chinese name of 72985-51-4? |
| A: Chinese name of 72985-51-4 is 72985-51-4. |
| Q: What is the InChIKey of 8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione? |
| A: InChIKey of 8-Methoxy-5-methyl-2H-3,1-benzoxazine-2,4(1H)-dione is KCCCYZCHTJDJMY-UHFFFAOYSA-N. |