hexanedioic acid,hexane-1,6-diol,1-isocyanato-2-[(2-isocyanatophenyl)methyl]benzene
Modify Date: 2025-08-25 10:05:29
![hexanedioic acid,hexane-1,6-diol,1-isocyanato-2-[(2-isocyanatophenyl)methyl]benzene Structure](https://image.chemsrc.com/caspic/006/72960-42-0.png)
hexanedioic acid,hexane-1,6-diol,1-isocyanato-2-[(2-isocyanatophenyl)methyl]benzene structure
|
Common Name | hexanedioic acid,hexane-1,6-diol,1-isocyanato-2-[(2-isocyanatophenyl)methyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 72960-42-0 | Molecular Weight | 514.56700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H34N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | hexanedioic acid,hexane-1,6-diol,1-isocyanato-2-[(2-isocyanatophenyl)methyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H34N2O8 |
|---|---|
| Molecular Weight | 514.56700 |
| Exact Mass | 514.23200 |
| PSA | 173.92000 |
| LogP | 4.45940 |
| InChIKey | DHCQSUUYIYQVOY-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCC(=O)O.O=C=Nc1ccccc1Cc1ccccc1N=C=O.OCCCCCCO |
| Diphenylmethanediisocyanate,1,6-hexanediol,adipic acid polymer |
| Hexanedioic acid,polymer with 1,6-hexanediol and 1,1'-methylenebis(isocyanatobenzene) |