5-[(4-Chlorophenyl)hydrazono]pyrimidine-2,4,6(1H,3H)-trione
Modify Date: 2025-09-12 08:08:53
![5-[(4-Chlorophenyl)hydrazono]pyrimidine-2,4,6(1H,3H)-trione Structure](https://image.chemsrc.com/caspic/499/7293-30-3.png)
5-[(4-Chlorophenyl)hydrazono]pyrimidine-2,4,6(1H,3H)-trione structure
|
Common Name | 5-[(4-Chlorophenyl)hydrazono]pyrimidine-2,4,6(1H,3H)-trione | ||
|---|---|---|---|---|
| CAS Number | 7293-30-3 | Molecular Weight | 266.64100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7ClN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4,5,6(1H,3H)-Pyrimidinetetrone, 5-[(4-chlorophenyl)hydrazone] (en) |
|---|
| Molecular Formula | C10H7ClN4O3 |
|---|---|
| Molecular Weight | 266.64100 |
| Exact Mass | 266.02100 |
| PSA | 99.66000 |
| LogP | 1.20450 |
| InChIKey | WLCOGDPXTKQCFC-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(O)c(N=Nc2ccc(Cl)cc2)c(=O)[nH]1 |
|
~%
5-[(4-Chlorophe... CAS#:7293-30-3 |
| Literature: Beaton, Haydn G.; Willey, Gerald R.; Drew, Michael G. B. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1987 , p. 469 - 472 |
|
~%
5-[(4-Chlorophe... CAS#:7293-30-3 |
| Literature: King et al. Journal of the Chemical Society, 1947 , p. 1247 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |