4,8-diamino-2,3,6-tribromo-naphthalene-1,5-dione structure
|
Common Name | 4,8-diamino-2,3,6-tribromo-naphthalene-1,5-dione | ||
|---|---|---|---|---|
| CAS Number | 72918-29-7 | Molecular Weight | 424.87100 | |
| Density | 2.48g/cm3 | Boiling Point | 310.6ºC at 760 mmHg | |
| Molecular Formula | C10H5Br3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.7ºC | |
| Name | 4,8-diamino-2,3,6-tribromonaphthalene-1,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 2.48g/cm3 |
|---|---|
| Boiling Point | 310.6ºC at 760 mmHg |
| Molecular Formula | C10H5Br3N2O2 |
| Molecular Weight | 424.87100 |
| Flash Point | 141.7ºC |
| Exact Mass | 421.79000 |
| PSA | 86.18000 |
| LogP | 3.25820 |
| Index of Refraction | 1.8 |
| InChIKey | WTYRWWBFBZQKRB-UHFFFAOYSA-N |
| SMILES | N=C1C(Br)=C(Br)C(=O)c2c(N)cc(Br)c(O)c21 |
| HS Code | 2925290090 |
|---|
|
~%
4,8-diamino-2,3... CAS#:72918-29-7 |
| Literature: Sandoz Patent: US2553048 , 1949 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 5-Amino-2,3,7-tribrom-8-hydroxy-[1,4]naphthochinon-1-imin |
| 2,3,7-Tribromo-5-amino-8-hydroxy-1,4-naphthoquinone-1-imine |
| 1(4H)-Naphthalenone,8-amino-2,3,6-tribromo-5-hydroxy-4-imino |
| 4,8-DIAMINO-2,3,6-TRIBROMO-NAPHTHALENE-1,5-DIONE |
| 5-amino-2,3,7-tribromo-8-hydroxy-[1,4]naphthoquinone-1-imine |
| 1,4-Naphthoquinoneimine,8-amino-2,3,6-tribromo-5-hydroxy-(5CI) |