1,5-dimethylbicyclo[3.2.1]oct-8-yl isobutyrate structure
|
Common Name | 1,5-dimethylbicyclo[3.2.1]oct-8-yl isobutyrate | ||
|---|---|---|---|---|
| CAS Number | 72903-10-7 | Molecular Weight | 224.33900 | |
| Density | 0.98g/cm3 | Boiling Point | 248.5ºC at 760 mmHg | |
| Molecular Formula | C14H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.1ºC | |
| Name | (1,5-dimethyl-8-bicyclo[3.2.1]octanyl) 2-methylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.98g/cm3 |
|---|---|
| Boiling Point | 248.5ºC at 760 mmHg |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.33900 |
| Flash Point | 108.1ºC |
| Exact Mass | 224.17800 |
| PSA | 26.30000 |
| LogP | 3.54450 |
| Index of Refraction | 1.479 |
| InChIKey | KHQBRKIBDIDREL-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)OC1C2(C)CCCC1(C)CC2 |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| EINECS 276-977-4 |
| 1,5-Dimethylbicyclo(3.2.1)oct-8-yl isobutyrate |