1,2-Dimethyl-4,5-dioxo-1,3-cyclopentanedicarboxylic acid diethyl ester structure
|
Common Name | 1,2-Dimethyl-4,5-dioxo-1,3-cyclopentanedicarboxylic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 72894-17-8 | Molecular Weight | 270.27800 | |
| Density | 1.183g/cm3 | Boiling Point | 359.8ºC at 760 mmHg | |
| Molecular Formula | C13H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.1ºC | |
| Name | diethyl 1,2-dimethyl-4,5-dioxocyclopentane-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 359.8ºC at 760 mmHg |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.27800 |
| Flash Point | 157.1ºC |
| Exact Mass | 270.11000 |
| PSA | 86.74000 |
| LogP | 0.52300 |
| Index of Refraction | 1.47 |
| InChIKey | GUKROTILZBCYNM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(=O)C(=O)C(C)(C(=O)OCC)C1C |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,3-Cyclopentanedicarboxylic acid,4,5-dioxo-1,2-dimethyl-,diethyl ester |
| 1,2-dimethyl-4,5-dioxo-cyclopentane-1,3-dicarboxylic acid diethyl ester |
| 4,5-Dioxo-1,2-dimethyl-cyclopentan-1,3-dicarbonsaeure-diethylester |
| 1,3-Cyclopentanedicarboxylic acid,1,2-dimethyl-4,5-dioxo-,diethyl ester |
| 1,2-Dimethyl-4,5-dioxo-cyclopentan-1,3-dicarbonsaeure-diaethylester |
| 1,3-Cyclopentanedicarboxylic acid,1,2-dimethyl-4,5-dioxo-,1,3-diethyl ester |