Ethyl 2,6-dichlorobenzoylacetate structure
|
Common Name | Ethyl 2,6-dichlorobenzoylacetate | ||
|---|---|---|---|---|
| CAS Number | 72835-87-1 | Molecular Weight | 261.10100 | |
| Density | 1.319 g/cm3 | Boiling Point | 290.6ºC at 760 mmHg | |
| Molecular Formula | C11H10Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.7ºC | |
| Name | ethyl 3-(2,6-dichlorophenyl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.319 g/cm3 |
|---|---|
| Boiling Point | 290.6ºC at 760 mmHg |
| Molecular Formula | C11H10Cl2O3 |
| Molecular Weight | 261.10100 |
| Flash Point | 109.7ºC |
| Exact Mass | 260.00100 |
| PSA | 43.37000 |
| LogP | 3.12930 |
| InChIKey | GJUHMKHPXHMWQI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1c(Cl)cccc1Cl |
| HS Code | 2918300090 |
|---|
|
~59%
Ethyl 2,6-dichl... CAS#:72835-87-1 |
| Literature: Bloomfield, Derek G.; Upton, Christopher; Vipond, Hilton J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1986 , p. 857 - 860 |
|
~%
Ethyl 2,6-dichl... CAS#:72835-87-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 55, # 22 p. 10090 - 10107 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,6-Dichloro-beta-Oxo-Benzenepropanoic Acid Ethyl Ester |
| AC-7796 |
| ethyl 2,6-dichlorobenzoylacetate |