2-imidazol-1-yl-1-(4-phenylphenyl)ethanone
Modify Date: 2025-08-28 13:39:05
2-imidazol-1-yl-1-(4-phenylphenyl)ethanone structure
|
Common Name | 2-imidazol-1-yl-1-(4-phenylphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 72825-24-2 | Molecular Weight | 262.30600 | |
| Density | 1.12g/cm3 | Boiling Point | 499.3ºC at 760 mmHg | |
| Molecular Formula | C17H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.8ºC | |
| Name | 2-imidazol-1-yl-1-(4-phenylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 499.3ºC at 760 mmHg |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.30600 |
| Flash Point | 255.8ºC |
| Exact Mass | 262.11100 |
| PSA | 34.89000 |
| LogP | 3.43300 |
| Index of Refraction | 1.611 |
| InChIKey | CTBDNAHBIPBRTI-UHFFFAOYSA-N |
| SMILES | O=C(Cn1ccnc1)c1ccc(-c2ccccc2)cc1 |
|
~95%
2-imidazol-1-yl... CAS#:72825-24-2 |
| Literature: Lin, Chun Min; Wong, Fung Fuh; Huang, Jiann-Jyh; Yeh, Mou-Yung Heterocycles, 2006 , vol. 68, # 7 p. 1359 - 1370 |
|
~67%
2-imidazol-1-yl... CAS#:72825-24-2 |
| Literature: Nardi; Tajana; Leonardi; Pennini; Portioli; Magistretti; Subissi Journal of Medicinal Chemistry, 1981 , vol. 24, # 6 p. 727 - 731 |
|
~%
2-imidazol-1-yl... CAS#:72825-24-2 |
| Literature: Tajana; Cappelletti; Leonardi; Veronese Arzneimittel-Forschung/Drug Research, 1982 , vol. 31, # 12 p. 2121 - 2123 |
![1,3-bis(2-([1,1'-biphenyl]-4-yl)-2-oxoethyl)-1H-imidazol-3-ium chloride structure](https://image.chemsrc.com/caspic/354/77243-17-5.png)
CAS#:104-83-6
CAS#:72825-25-3| N-(4-phenyl)phenacylimidazole |
| 1-(1,1'-biphenyl-4-yl)-2-(1H-imidazol-1-yl)ethanone |
| 1-biphenyl-4-yl-2-imidazol-1-yl-ethanone |
| N-((4-Phenylbenzoyl)methyl)imidazole |
| ACETOPHENONE,2-(1-IMIDAZOLYL)-4'-PHENYL |
| 1-(biphenyl-4-yl)-2-(imidazole-1-yl)ethanone |
| 4-biphenylyl imidazol-1-yl-methyl ketone |
| 4-(N-imidazolyl-acetyl)-biphenyl |