4-(3-methylphenyl)-1,1-dioxopyrido[4,3-e][1,2,4]thiadiazin-3-one structure
|
Common Name | 4-(3-methylphenyl)-1,1-dioxopyrido[4,3-e][1,2,4]thiadiazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 72810-61-8 | Molecular Weight | 289.31000 | |
| Density | 1.446g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H11N3O3S | Melting Point | 168-170ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-methylphenyl)-1,1-dioxopyrido[4,3-e][1,2,4]thiadiazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.446g/cm3 |
|---|---|
| Melting Point | 168-170ºC |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.31000 |
| Exact Mass | 289.05200 |
| PSA | 87.75000 |
| LogP | 3.41460 |
| Index of Refraction | 1.649 |
| InChIKey | QMCVPDNHQUBJPG-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N2C(=O)NS(=O)(=O)c3cnccc32)c1 |
| RIDADR | NONH for all modes of transport |
|---|
| UNII-S2V55A7A7X |
| 4-m-Tolyl-2H-pyrido(4,3-E)(1,2,4)thiadiazin-3(4H)-one 1,1-dioxide |
| Torsemide related compound E |
| Torsemide related compound E RS [USP] |
| 4-(3-METHYLPHENYL)-2H-PYRIDO[4,3-E]-1,2,4-THIADIAZIN-3(4H)-ONE 1,1-DIOXIDE |
| 4-(3-Methylphenyl)-2H-pyrido[4,3-e]-1,2,4-thiadiazin-3(4H)-one 1,1-Dioxide (Torsemide impurity) |