DiMethyl4-(TrifluoroMethyl)phthalate
Modify Date: 2025-09-09 11:30:15
DiMethyl4-(TrifluoroMethyl)phthalate structure
|
Common Name | DiMethyl4-(TrifluoroMethyl)phthalate | ||
|---|---|---|---|---|
| CAS Number | 728-47-2 | Molecular Weight | 262.182 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 270.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C11H9F3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.9±22.2 °C | |
| Name | dimethyl 4-(trifluoromethyl)benzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 270.5±40.0 °C at 760 mmHg |
| Molecular Formula | C11H9F3O4 |
| Molecular Weight | 262.182 |
| Flash Point | 113.9±22.2 °C |
| Exact Mass | 262.045288 |
| PSA | 52.60000 |
| LogP | 3.09 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | GWLSBQYCLOXJTQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(F)(F)F)cc1C(=O)OC |
| HS Code | 2917399090 |
|---|
|
~77%
DiMethyl4-(Trif... CAS#:728-47-2 |
| Literature: Volle, Jean-Noel; Schlosser, Manfred European Journal of Organic Chemistry, 2002 , # 9 p. 1490 - 1492 |
|
~%
DiMethyl4-(Trif... CAS#:728-47-2 |
| Literature: Ponomarenko, Maxim V.; Lummer, Katrin; Fokin, Andrey A.; Serguchev, Yurii A.; Bassil, Bassem S.; Roeschenthaler, Gerd-Volker Organic and Biomolecular Chemistry, 2013 , vol. 11, # 46 p. 8103 - 8112 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Dimethyl 4-(trifluoromethyl)phthalate |
| 4-Trifluormethyl-phthalsaeure-dimethylester |
| WT310 |
| 1,2-Benzenedicarboxylic acid, 4-(trifluoromethyl)-, dimethyl ester |
| DiMethyl4-(TrifluoroMethyl)phthalate |