potassium,2-aminoethanesulfonate,1,3-bis(ethenylsulfonyl)-2,2-bis(ethenylsulfonylmethyl)propane
Modify Date: 2025-09-15 09:00:42
potassium,2-aminoethanesulfonate,1,3-bis(ethenylsulfonyl)-2,2-bis(ethenylsulfonylmethyl)propane structure
|
Common Name | potassium,2-aminoethanesulfonate,1,3-bis(ethenylsulfonyl)-2,2-bis(ethenylsulfonylmethyl)propane | ||
|---|---|---|---|---|
| CAS Number | 72796-94-2 | Molecular Weight | 595.79000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26KNO11S5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | potassium,2-aminoethanesulfonate,1,3-bis(ethenylsulfonyl)-2,2-bis(ethenylsulfonylmethyl)propane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H26KNO11S5 |
|---|---|
| Molecular Weight | 595.79000 |
| Exact Mass | 594.97500 |
| PSA | 261.68000 |
| LogP | 4.80060 |
| InChIKey | MOSGFLPYMUBFCM-UHFFFAOYSA-M |
| SMILES | C=CS(=O)(=O)CC(CS(=O)(=O)C=C)(CS(=O)(=O)C=C)CS(=O)(=O)C=C.NCCS(=O)(=O)[O-].[K+] |
| Ethanesulfonic acid,2-amino-,monopotassium salt,polymer with 1,3-bis(ethenylsulfonyl)-2,2-bis((ethenylsulfonyl)methyl)propane |
| Ethanesulfonic acid,2-amino-,potassium salt,polymer with 1,3-bis(ethenylsulfonyl)-2,2-bis((ethenylsulfonyl)methyl)propane |
| Ethanesulfonic acid,2-amino-,potassium salt (1:1),polymer with 1,3-bis(ethenylsulfonyl)-2,2-bis((ethenylsulfonyl)methyl)propane |