1,3,5-TRIAZINE-2,4-DIAMINE, 6-(2-METHOXYPHENYL)-
Modify Date: 2025-11-25 17:28:27
1,3,5-TRIAZINE-2,4-DIAMINE, 6-(2-METHOXYPHENYL)- structure
|
Common Name | 1,3,5-TRIAZINE-2,4-DIAMINE, 6-(2-METHOXYPHENYL)- | ||
|---|---|---|---|---|
| CAS Number | 72775-80-5 | Molecular Weight | 217.22700 | |
| Density | 1.333g/cm3 | Boiling Point | 531ºC at 760 mmHg | |
| Molecular Formula | C10H11N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275ºC | |
| Name | 6-(2-Methoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 531ºC at 760 mmHg |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.22700 |
| Flash Point | 275ºC |
| Exact Mass | 217.09600 |
| PSA | 101.40000 |
| LogP | 0.57180 |
| Index of Refraction | 1.661 |
| InChIKey | GKMGVJQSEMDNAT-UHFFFAOYSA-N |
| SMILES | COc1ccccc1-c1nc(N)nc(N)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 6-(2-Methoxy-phenyl)-[1,3,5]triazine-2,4-diamine |
| 2-<2-Methoxy-phenyl>-4,6-diamino-1,3,5-triazin |