1H-Pyrrolo(2,1-a)isoindole-6,9-dione, 2,3-dihydro-7-methyl-5-phenyl- structure
|
Common Name | 1H-Pyrrolo(2,1-a)isoindole-6,9-dione, 2,3-dihydro-7-methyl-5-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 72726-08-0 | Molecular Weight | 277.31700 | |
| Density | 1.3g/cm3 | Boiling Point | 540.5ºC at 760 mmHg | |
| Molecular Formula | C18H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.7ºC | |
| Name | 7-methyl-5-phenyl-2,3-dihydro-1H-pyrrolo[2,1-a]isoindole-6,9-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 540.5ºC at 760 mmHg |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.31700 |
| Flash Point | 280.7ºC |
| Exact Mass | 277.11000 |
| PSA | 39.07000 |
| LogP | 3.42660 |
| Index of Refraction | 1.683 |
| InChIKey | GLZBEJMTFMQCAZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)c2c(c(-c3ccccc3)n3c2CCC3)C1=O |
|
~%
1H-Pyrrolo(2,1-... CAS#:72726-08-0 |
| Literature: Nan'ya, Seiko; Tange, Toshiaki; Maekawa, Eturo; Ueno, Yoshio Journal of Heterocyclic Chemistry, 1986 , vol. 23, p. 1267 - 1271 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Methyl-1,2-trimethylene-3-phenyl-2H-isoindole-4,7-dione |
| 6-methyl-1-phenyl-2,3-trimethylene-2H-isoindole-4,7-dione |
| 1H-Pyrrolo(2,1-a)isoindole-6,9-dione,2,3-dihydro-7-methyl-5-phenyl |