LS2265
Modify Date: 2025-08-25 09:41:37
LS2265 structure
|
Common Name | LS2265 | ||
|---|---|---|---|---|
| CAS Number | 72678-30-9 | Molecular Weight | 425.88300 | |
| Density | 1.371g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H20ClNO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LS2265LS2265 is a taurine derivative of fenofibrate and can induce proliferation of peroxisomes in liver cells of rats. |
| Name | 2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | LS2265 is a taurine derivative of fenofibrate and can induce proliferation of peroxisomes in liver cells of rats. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.371g/cm3 |
|---|---|
| Molecular Formula | C19H20ClNO6S |
| Molecular Weight | 425.88300 |
| Exact Mass | 425.07000 |
| PSA | 121.64000 |
| LogP | 4.65350 |
| Index of Refraction | 1.589 |
| InChIKey | IYNIXDBLAVOMAW-UHFFFAOYSA-N |
| SMILES | CC(C)(Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)NCCS(=O)(=O)O |
| Storage condition | 2-8℃ |
| Ethanesulfonic acid,2-((2-(4-(4-chlorobenzoyl)phenoxy)-2-methyl-1-oxopropyl)amino) |
| 2-({2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl}amino)ethanesulfonic acid |
| LS2265 |