pyrenocine B
Modify Date: 2025-09-13 15:46:53
pyrenocine B structure
|
Common Name | pyrenocine B | ||
|---|---|---|---|---|
| CAS Number | 72674-29-4 | Molecular Weight | 226.22600 | |
| Density | 1.23g/cm3 | Boiling Point | 411.8ºC at 760 mmHg | |
| Molecular Formula | C11H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.1ºC | |
| Name | 5-(3-hydroxybutanoyl)-4-methoxy-6-methylpyran-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 411.8ºC at 760 mmHg |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.22600 |
| Flash Point | 161.1ºC |
| Exact Mass | 226.08400 |
| PSA | 76.74000 |
| LogP | 0.91040 |
| Index of Refraction | 1.517 |
| InChIKey | NXDGLHJHHJJTSZ-UHFFFAOYSA-N |
| SMILES | COc1cc(=O)oc(C)c1C(=O)CC(C)O |
|
~40%
pyrenocine B CAS#:72674-29-4 |
| Literature: Ichihara, Akitami; Murakami, Kazuo; Sakamura, Sadao Tetrahedron Letters, 1981 , vol. 22, # 40 p. 4005 - 4006 |
|
~23%
pyrenocine B CAS#:72674-29-4 |
| Literature: Ichihara, Akitami; Murakami, Kazuo; Sakamura, Sadao Tetrahedron, 1987 , vol. 43, # 22 p. 5245 - 5250 |
|
~%
pyrenocine B CAS#:72674-29-4 |
| Literature: Ichihara, Akitami; Murakami, Kazuo; Sakamura, Sadao Tetrahedron Letters, 1981 , vol. 22, # 40 p. 4005 - 4006 Title/Abstract View citing articles Show Details Ichihara, Akitami; Murakami, Kazuo; Sakamura, Sadao Tetrahedron, 1987 , vol. 43, # 22 p. 5245 - 5250 |
|
~20%
pyrenocine B CAS#:72674-29-4
Detail
|
| Literature: Sakurai, Ikuo; Miyajima, Hisae; Akiyama, Katsuyoshi; Shimizu, Sakae; Yamamoto, Yuzuru Chemical and Pharmaceutical Bulletin, 1988 , vol. 36, p. 2003 - 2011 |
![5-hydroxy-4-methoxy-5,7-dimethyl-7,8-dihydro-2H,5H-pyrano[4,3-b]pyran-2-one structure](https://image.chemsrc.com/caspic/449/80927-99-7.png)
| 2H-Pyran-2-one,5-(3-hydroxy-1-oxobutyl)-4-methoxy-6-methyl-,(+) |
| Pyrenocin B |
| pirenocyne B |
| pyrenocine B |