tris(3-isopropylphenyl) phosphate
Modify Date: 2025-08-30 10:18:07
tris(3-isopropylphenyl) phosphate structure
|
Common Name | tris(3-isopropylphenyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 72668-27-0 | Molecular Weight | 452.52200 | |
| Density | 1.108g/cm3 | Boiling Point | 486.7ºC at 760 mmHg | |
| Molecular Formula | C27H33O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.3ºC | |
| Name | tris(3-propan-2-ylphenyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.108g/cm3 |
|---|---|
| Boiling Point | 486.7ºC at 760 mmHg |
| Molecular Formula | C27H33O4P |
| Molecular Weight | 452.52200 |
| Flash Point | 261.3ºC |
| Exact Mass | 452.21200 |
| PSA | 54.57000 |
| LogP | 8.70170 |
| Index of Refraction | 1.551 |
| InChIKey | HZZVNABLNATHQO-UHFFFAOYSA-N |
| SMILES | CC(C)c1cccc(OP(=O)(Oc2cccc(C(C)C)c2)Oc2cccc(C(C)C)c2)c1 |
| HS Code | 2919900090 |
|---|
|
~%
tris(3-isopropy... CAS#:72668-27-0 |
| Literature: Honkakoski, Paavo; Palvimo, Jorma J.; Penttilae, Leena; Vepsaelaeinen, Jouko; Auriola, Seppo Biochemical Pharmacology, 2004 , vol. 67, # 1 p. 97 - 106 |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| einecs 276-759-9 |