1-Piperazineacetic acid, 4-methyl-, 2-(1-naphthylmethylene)hydrazide structure
|
Common Name | 1-Piperazineacetic acid, 4-methyl-, 2-(1-naphthylmethylene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 72606-48-5 | Molecular Weight | 310.39300 | |
| Density | 1.175g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H22N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-methylpiperazin-1-yl)-N-[(E)-naphthalen-1-ylmethylideneamino]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.175g/cm3 |
|---|---|
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.39300 |
| Exact Mass | 310.17900 |
| PSA | 51.43000 |
| LogP | 2.25340 |
| Index of Refraction | 1.618 |
| InChIKey | QWMFUGWECVGIDB-CPNJWEJPSA-N |
| SMILES | CN1CCN(CC(=O)NN=Cc2cccc3ccccc23)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Methyl-1-piperazineacetic acid 2-(1-naphthylmethylene)hydrazide |
| 1-Piperazineacetic acid,4-methyl-,2-(1-naphthylmethylene)hydrazide |