O-(3-amino-5-nitrophenyl)-1-(2-methoxyphenyl)ethanone oxime
Modify Date: 2025-09-23 19:05:53
O-(3-amino-5-nitrophenyl)-1-(2-methoxyphenyl)ethanone oxime structure
|
Common Name | O-(3-amino-5-nitrophenyl)-1-(2-methoxyphenyl)ethanone oxime | ||
|---|---|---|---|---|
| CAS Number | 725698-74-8 | Molecular Weight | 301.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | O-(3-amino-5-nitrophenyl)-1-(2-methoxyphenyl)ethanone oxime |
|---|
| Molecular Formula | C15H15N3O4 |
|---|---|
| Molecular Weight | 301.29700 |
| Exact Mass | 301.10600 |
| PSA | 102.66000 |
| LogP | 4.09300 |
| InChIKey | JUWVEZYWYJSXFC-LICLKQGHSA-N |
| SMILES | COc1ccccc1C(C)=NOc1cc(N)cc([N+](=O)[O-])c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |