2-((3-Chlorophenylthio)methyl)-3-hydroxynaphthalene-1,4-dione structure
|
Common Name | 2-((3-Chlorophenylthio)methyl)-3-hydroxynaphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 72520-37-7 | Molecular Weight | 330.78500 | |
| Density | 1.48g/cm3 | Boiling Point | 511.5ºC at 760 mmHg | |
| Molecular Formula | C17H11ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(((4-chlorophenyl)thio)methyl)-3-hydroxynaphthalene-1,4-dione |
|---|
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 511.5ºC at 760 mmHg |
| Molecular Formula | C17H11ClO3S |
| Molecular Weight | 330.78500 |
| Exact Mass | 330.01200 |
| PSA | 79.67000 |
| LogP | 4.32340 |
| Index of Refraction | 1.707 |
| InChIKey | QXGGYTCKICEBFY-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)c2ccccc2C(O)=C1CSc1ccc(Cl)cc1 |
|
~77%
2-((3-Chlorophe... CAS#:72520-37-7 |
| Literature: Sharma, Abhinay; Santos, Isabela O.; Gaur, Pratibha; Ferreira, Vitor F.; Garcia, Celia R.S.; Da Rocha, David R. European Journal of Medicinal Chemistry, 2013 , vol. 59, p. 48 - 53 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |