4-(benzo[1,3]dioxol-5-ylmethylideneamino)-5-methyl-2-propan-2-yl-phenol structure
|
Common Name | 4-(benzo[1,3]dioxol-5-ylmethylideneamino)-5-methyl-2-propan-2-yl-phenol | ||
|---|---|---|---|---|
| CAS Number | 7251-20-9 | Molecular Weight | 297.34800 | |
| Density | 1.19g/cm3 | Boiling Point | 471.7ºC at 760 mmHg | |
| Molecular Formula | C18H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.1ºC | |
| Name | 4-(1,3-benzodioxol-5-ylmethylideneamino)-5-methyl-2-propan-2-ylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 471.7ºC at 760 mmHg |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.34800 |
| Flash Point | 239.1ºC |
| Exact Mass | 297.13600 |
| PSA | 51.05000 |
| LogP | 4.30330 |
| Index of Refraction | 1.589 |
| InChIKey | MSSWKSMLJGXDPN-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(C(C)C)cc1N=Cc1ccc2c(c1)OCO2 |
|
~%
4-(benzo[1,3]di... CAS#:7251-20-9 |
| Literature: Sumerford; Hartung; Jenkins Journal of the American Chemical Society, 1940 , vol. 62, p. 2082 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Piperonal-(4-hydroxy-5-isopropyl-2-methyl-phenylimin) |
| 4-{[(e)-1,3-benzodioxol-5-ylmethylidene]amino}-5-methyl-2-(propan-2-yl)phenol |
| piperonal-(4-hydroxy-5-isopropyl-2-methyl-phenylimine) |