Phthalimide,N,N'-(2-bromotrimethylene)di- (8CI)
Modify Date: 2025-09-20 18:07:04
Phthalimide,N,N'-(2-bromotrimethylene)di- (8CI) structure
|
Common Name | Phthalimide,N,N'-(2-bromotrimethylene)di- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 7249-91-4 | Molecular Weight | 413.22200 | |
| Density | 1.66g/cm3 | Boiling Point | 554.5ºC at 760 mmHg | |
| Molecular Formula | C19H13BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.2ºC | |
| Name | 2-[2-bromo-3-(1,3-dioxoisoindol-2-yl)propyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66g/cm3 |
|---|---|
| Boiling Point | 554.5ºC at 760 mmHg |
| Molecular Formula | C19H13BrN2O4 |
| Molecular Weight | 413.22200 |
| Flash Point | 289.2ºC |
| Exact Mass | 412.00600 |
| PSA | 74.76000 |
| LogP | 2.21810 |
| Index of Refraction | 1.688 |
| InChIKey | ZCEAEAUUCRSZEW-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CC(Br)CN1C(=O)c2ccccc2C1=O |
|
~%
Phthalimide,N,N... CAS#:7249-91-4 |
| Literature: Mann Journal of the Chemical Society, 1927 , p. 2912 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-bromo-1,3,5-trinitro-benzene |
| Benzene,2-bromo-1,3,5-trinitro |
| 2-bromo-1,3-diphthalimido-propane |
| 2-Brom-1,3,5-trinitro-benzol |
| picryl bromide |
| 2-Brom-1,3-diphthalimido-propan |