1,3-bis[(4-methoxyphenyl)methyl]-2-propyl-imidazolidine structure
|
Common Name | 1,3-bis[(4-methoxyphenyl)methyl]-2-propyl-imidazolidine | ||
|---|---|---|---|---|
| CAS Number | 7248-51-3 | Molecular Weight | 354.48600 | |
| Density | 1.075g/cm3 | Boiling Point | 460.6ºC at 760 mmHg | |
| Molecular Formula | C22H30N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.1ºC | |
| Name | 1,3-bis[(4-methoxyphenyl)methyl]-2-propylimidazolidine |
|---|
| Density | 1.075g/cm3 |
|---|---|
| Boiling Point | 460.6ºC at 760 mmHg |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.48600 |
| Flash Point | 126.1ºC |
| Exact Mass | 354.23100 |
| PSA | 24.94000 |
| LogP | 4.02360 |
| Index of Refraction | 1.56 |
| InChIKey | BKZFCBJHCACQAF-UHFFFAOYSA-N |
| SMILES | CCCC1N(Cc2ccc(OC)cc2)CCN1Cc1ccc(OC)cc1 |
|
~%
1,3-bis[(4-meth... CAS#:7248-51-3 |
| Literature: Billman et al. Journal of Organic Chemistry, 1952 , vol. 17, p. 1375,1376 |
|
~%
1,3-bis[(4-meth... CAS#:7248-51-3 |
| Literature: Billman et al. Journal of Organic Chemistry, 1952 , vol. 17, p. 1375,1376 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |