Licoflavone C
Modify Date: 2025-08-26 22:10:34
Licoflavone C structure
|
Common Name | Licoflavone C | ||
|---|---|---|---|---|
| CAS Number | 72357-31-4 | Molecular Weight | 338.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Licoflavone CLicoflavone C is a prenyl-flavone extracted from Genista ephedroides, reduces the genotoxicity of cancer drugs in human peripheral lymphocytes[1]. |
| Name | 4',5,7-trihydroxy-8-prenylflavone |
|---|---|
| Synonym | More Synonyms |
| Description | Licoflavone C is a prenyl-flavone extracted from Genista ephedroides, reduces the genotoxicity of cancer drugs in human peripheral lymphocytes[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H18O5 |
|---|---|
| Molecular Weight | 338.35400 |
| Exact Mass | 338.11500 |
| PSA | 90.90000 |
| LogP | 4.08550 |
| InChIKey | MEHHCBRCXIDGKZ-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1c(O)cc(O)c2c(=O)cc(-c3ccc(O)cc3)oc12 |
| Storage condition | 2-8°C |
| 8-prenylapigenin |
| isocannflavin B |
| 5,7-Dihydroxy-2-(4-hydroxy-phenyl)-8-(3-methyl-but-2-enyl)-chromen-4-one |
| 8-Prenylapigenin |
| 5,7,4'-trihydroxy-8-prenylflavone |