methyl 2-hydroxy-4-methoxy-5-nitrobenzoate structure
|
Common Name | methyl 2-hydroxy-4-methoxy-5-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 723284-34-2 | Molecular Weight | 227.17100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-hydroxy-4-methoxy-5-nitrobenzoate |
|---|
| Molecular Formula | C9H9NO6 |
|---|---|
| Molecular Weight | 227.17100 |
| Exact Mass | 227.04300 |
| PSA | 101.58000 |
| LogP | 1.61880 |
| InChIKey | OZDKGSVJTFJYOC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(OC)cc1O |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |