methoxy(phenylmethoxycarbonyl)phosphinic acid
Modify Date: 2024-09-20 17:07:30
methoxy(phenylmethoxycarbonyl)phosphinic acid structure
|
Common Name | methoxy(phenylmethoxycarbonyl)phosphinic acid | ||
|---|---|---|---|---|
| CAS Number | 72304-92-8 | Molecular Weight | 230.15400 | |
| Density | 1.351g/cm3 | Boiling Point | 357.4ºC at 760 mmHg | |
| Molecular Formula | C9H11O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170ºC | |
| Name | methoxy(phenylmethoxycarbonyl)phosphinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.351g/cm3 |
|---|---|
| Boiling Point | 357.4ºC at 760 mmHg |
| Molecular Formula | C9H11O5P |
| Molecular Weight | 230.15400 |
| Flash Point | 170ºC |
| Exact Mass | 230.03400 |
| PSA | 82.64000 |
| LogP | 2.15500 |
| Index of Refraction | 1.527 |
| InChIKey | FGSQYHTUTMWRDZ-UHFFFAOYSA-N |
| SMILES | COP(=O)(O)C(=O)OCc1ccccc1 |
|
~80%
methoxy(phenylm... CAS#:72304-92-8 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
|
~%
methoxy(phenylm... CAS#:72304-92-8 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| sodium methyl (benzyloxycarbonyl)phosphonate |
| Phosphinecarboxylic acid,hydroxymethoxy-,phenylmethyl ester,oxide |