methyl [(2,6-dimethylphenoxy)-ethoxyphosphoryl]formate structure
|
Common Name | methyl [(2,6-dimethylphenoxy)-ethoxyphosphoryl]formate | ||
|---|---|---|---|---|
| CAS Number | 72304-87-1 | Molecular Weight | 272.23400 | |
| Density | 1.186g/cm3 | Boiling Point | 338.7ºC at 760 mmHg | |
| Molecular Formula | C12H17O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.4ºC | |
| Name | methyl [(2,6-dimethylphenoxy)-ethoxyphosphoryl]formate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 338.7ºC at 760 mmHg |
| Molecular Formula | C12H17O5P |
| Molecular Weight | 272.23400 |
| Flash Point | 172.4ºC |
| Exact Mass | 272.08100 |
| PSA | 71.64000 |
| LogP | 3.67820 |
| Index of Refraction | 1.494 |
| InChIKey | XFULWVNGDGCFGD-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(Oc1c(C)cccc1C)C(=O)OC |
|
~81%
methyl [(2,6-di... CAS#:72304-87-1 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| methyl (2,6-dimethylphenoxy)(ethoxy)phosphinecarboxylate oxide |
| Phosphinecarboxylic acid,(2,6-dimethylphenoxy)ethoxy-,methyl ester,oxide |
| ethyl 2,6-dimethylphenyl methoxycarbonylphosphonate |