phenyl [ethoxy-(4-methoxyphenoxy)phosphoryl]formate
Modify Date: 2025-09-26 11:23:12
![phenyl [ethoxy-(4-methoxyphenoxy)phosphoryl]formate Structure](https://image.chemsrc.com/caspic/292/72304-84-8.png)
phenyl [ethoxy-(4-methoxyphenoxy)phosphoryl]formate structure
|
Common Name | phenyl [ethoxy-(4-methoxyphenoxy)phosphoryl]formate | ||
|---|---|---|---|---|
| CAS Number | 72304-84-8 | Molecular Weight | 336.27600 | |
| Density | 1.261g/cm3 | Boiling Point | 431.2ºC at 760 mmHg | |
| Molecular Formula | C16H17O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.9ºC | |
| Name | phenyl [ethoxy-(4-methoxyphenoxy)phosphoryl]formate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 431.2ºC at 760 mmHg |
| Molecular Formula | C16H17O6P |
| Molecular Weight | 336.27600 |
| Flash Point | 227.9ºC |
| Exact Mass | 336.07600 |
| PSA | 80.87000 |
| LogP | 4.50260 |
| Index of Refraction | 1.541 |
| InChIKey | UFUOXRRWKKRSOH-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(Oc1ccc(OC)cc1)C(=O)Oc1ccccc1 |
|
~%
phenyl [ethoxy-... CAS#:72304-84-8 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
CAS#:63585-09-1![[hydroxy-(4-methoxyphenoxy)phosphoryl]formic acid structure](https://image.chemsrc.com/caspic/105/74270-25-0.png)
CAS#:74270-25-0| ethyl 4-methoxyphenyl (phenoxycarbonyl)phosphonate |
| Phosphinecarboxylic acid,ethoxy(4-methoxyphenoxy)-,phenyl ester,oxide |
| phenyl (4-methoxyphenoxy)(ethoxy)phosphinecarboxylate oxide |
| Ethyl,p-methoxyphenyl phenoxycarbonylphosphonate |