cyclopentylmethyl dimethoxyphosphorylformate
Modify Date: 2025-11-30 22:31:43
cyclopentylmethyl dimethoxyphosphorylformate structure
|
Common Name | cyclopentylmethyl dimethoxyphosphorylformate | ||
|---|---|---|---|---|
| CAS Number | 72304-83-7 | Molecular Weight | 236.20200 | |
| Density | 1.183g/cm3 | Boiling Point | 314.1ºC at 760 mmHg | |
| Molecular Formula | C9H17O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.6ºC | |
| Name | cyclopentylmethyl dimethoxyphosphorylformate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 314.1ºC at 760 mmHg |
| Molecular Formula | C9H17O5P |
| Molecular Weight | 236.20200 |
| Flash Point | 157.6ºC |
| Exact Mass | 236.08100 |
| PSA | 71.64000 |
| LogP | 2.79910 |
| Index of Refraction | 1.451 |
| InChIKey | JFIMJVVUALEVAC-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)C(=O)OCC1CCCC1 |
|
~61%
cyclopentylmeth... CAS#:72304-83-7 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:72305-05-6| cyclopentylmethyl dimethoxyphosphinecarboxylate oxide |
| Phosphinecarboxylic acid,dimethoxy-,cyclopentylmethyl ester,oxide |