ethyl diphenoxyphosphorylformate
Modify Date: 2025-11-26 10:21:44
ethyl diphenoxyphosphorylformate structure
|
Common Name | ethyl diphenoxyphosphorylformate | ||
|---|---|---|---|---|
| CAS Number | 72304-78-0 | Molecular Weight | 306.25000 | |
| Density | 1.263g/cm3 | Boiling Point | 392.7ºC at 760 mmHg | |
| Molecular Formula | C15H15O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.8ºC | |
| Name | ethyl diphenoxyphosphorylformate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 392.7ºC at 760 mmHg |
| Molecular Formula | C15H15O5P |
| Molecular Weight | 306.25000 |
| Flash Point | 204.8ºC |
| Exact Mass | 306.06600 |
| PSA | 71.64000 |
| LogP | 4.49400 |
| Index of Refraction | 1.548 |
| InChIKey | MSXLZDIUXZWZDO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)P(=O)(Oc1ccccc1)Oc1ccccc1 |
|
~%
ethyl diphenoxy... CAS#:72304-78-0 |
| Literature: Takamizawa,A.; Sato,Y. Chemical and Pharmaceutical Bulletin, 1964 , vol. 12, p. 398 - 403 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:72304-95-1| VIS 035 |
| Phosphinecarboxylic acid,diphenoxy-,ethyl ester,oxide |
| diphenyl ethoxycarbonylphosphonate |
| Diphenyl-aethoxycarbonylphosphit |
| Phosphinecarboxylicacid,1,1-diphenoxy-,ethyl ester,1-oxide |
| Ethyl diphenoxyphosphinecarboxylate oxide |