3-(4-dimethoxyphosphorylcarbonyloxyphenyl)propanoic acid structure
|
Common Name | 3-(4-dimethoxyphosphorylcarbonyloxyphenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 72304-76-8 | Molecular Weight | 302.21700 | |
| Density | 1.346g/cm3 | Boiling Point | 423.2ºC at 760 mmHg | |
| Molecular Formula | C12H15O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.7ºC | |
| Name | 3-(4-dimethoxyphosphorylcarbonyloxyphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.346g/cm3 |
|---|---|
| Boiling Point | 423.2ºC at 760 mmHg |
| Molecular Formula | C12H15O7P |
| Molecular Weight | 302.21700 |
| Flash Point | 209.7ºC |
| Exact Mass | 302.05600 |
| PSA | 108.94000 |
| LogP | 2.68850 |
| Index of Refraction | 1.521 |
| InChIKey | FOHANEWYENYFFG-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)C(=O)Oc1ccc(CCC(=O)O)cc1 |
|
~87%
3-(4-dimethoxyp... CAS#:72304-76-8 |
| Literature: Astra Lakemedel Aktiebolag Patent: US4386081 A1, 1983 ; |
|
~%
3-(4-dimethoxyp... CAS#:72304-76-8 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
|
~86%
3-(4-dimethoxyp... CAS#:72304-76-8 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Dimethyl 4-(ethoxycarbonyl)phenoxycarbonylphosphonate |
| Benzenepropanoic acid,4-[[(dimethoxyphosphinyl)carbonyl]oxy] |