N-(2,4-dimethylphenyl)-4-methyl-benzenesulfonamide structure
|
Common Name | N-(2,4-dimethylphenyl)-4-methyl-benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 7230-44-6 | Molecular Weight | 275.36600 | |
| Density | 1.211g/cm3 | Boiling Point | 410.2ºC at 760mmHg | |
| Molecular Formula | C15H17NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.9ºC | |
| Name | N-(2,4-dimethylphenyl)-4-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 410.2ºC at 760mmHg |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.36600 |
| Flash Point | 201.9ºC |
| Exact Mass | 275.09800 |
| PSA | 54.55000 |
| LogP | 4.56640 |
| InChIKey | UNYHHKHLLANCKH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C)cc2C)cc1 |
|
~%
N-(2,4-dimethyl... CAS#:7230-44-6 |
| Literature: Liang, Shengwen; Jensen, Michael P. Organometallics, 2012 , vol. 31, # 23 p. 8055 - 8058 |
|
~%
N-(2,4-dimethyl... CAS#:7230-44-6 |
| Literature: Bell Journal of the Chemical Society, 1955 , p. 2376,2379 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| toluene-4-sulfonic acid-(2,4-dimethyl-anilide) |
| F0808-1340 |
| N-(2,4-dimethylphenyl)-p-toluenesulfonamide |
| Toluol-4-sulfonsaeure-(2,4-dimethyl-anilid) |