3,3'-Thiobis[2-methylpropanoic acid methyl] ester
Modify Date: 2025-09-21 19:03:19
![3,3'-Thiobis[2-methylpropanoic acid methyl] ester Structure](https://image.chemsrc.com/caspic/090/72259-19-9.png)
3,3'-Thiobis[2-methylpropanoic acid methyl] ester structure
|
Common Name | 3,3'-Thiobis[2-methylpropanoic acid methyl] ester | ||
|---|---|---|---|---|
| CAS Number | 72259-19-9 | Molecular Weight | 234.31300 | |
| Density | 1.088g/cm3 | Boiling Point | 305.1ºC at 760 mmHg | |
| Molecular Formula | C10H18O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.8ºC | |
| Name | methyl 3-(3-methoxy-2-methyl-3-oxopropyl)sulfanyl-2-methylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.088g/cm3 |
|---|---|
| Boiling Point | 305.1ºC at 760 mmHg |
| Molecular Formula | C10H18O4S |
| Molecular Weight | 234.31300 |
| Flash Point | 133.8ºC |
| Exact Mass | 234.09300 |
| PSA | 77.90000 |
| LogP | 1.33780 |
| Index of Refraction | 1.467 |
| InChIKey | CMQPKQNBMBISIV-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)CSCC(C)C(=O)OC |
|
~43%
3,3'-Thiobis[2-... CAS#:72259-19-9 |
| Literature: Yu, Clinton; Kandur, Wynne; Kao, Athit; Rychnovsky, Scott; Huang, Lan Analytical Chemistry, 2014 , vol. 86, # 4 p. 2099 - 2106 |
|
~%
3,3'-Thiobis[2-... CAS#:72259-19-9 |
| Literature: Barkenbus et al. Journal of Organic Chemistry, 1951 , vol. 16, p. 232,236 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Dimethyl 3,3'-thiobis(2-methylpropionate) |
| Bis-(2-methoxycarbonyl-propyl)-sulfid |
| 2,6-dimethyl-4-thia-heptanedioic acid dimethyl ester |
| Propanoic acid,3,3'-thiobis(2-methyl-,dimethyl ester |
| dimethyl 3,3'-sulfanediylbis(2-methylpropanoate) |
| 2,6-Dimethyl-4-thia-heptandisaeure-dimethylester |