[3-(dibromomethyl)phenyl]-phenyl-methanone structure
|
Common Name | [3-(dibromomethyl)phenyl]-phenyl-methanone | ||
|---|---|---|---|---|
| CAS Number | 72235-46-2 | Molecular Weight | 354.03700 | |
| Density | 1.678g/cm3 | Boiling Point | 409.8ºC at 760 mmHg | |
| Molecular Formula | C14H10Br2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.5ºC | |
| Name | [3-(dibromomethyl)phenyl]-phenylmethanone |
|---|
| Density | 1.678g/cm3 |
|---|---|
| Boiling Point | 409.8ºC at 760 mmHg |
| Molecular Formula | C14H10Br2O |
| Molecular Weight | 354.03700 |
| Flash Point | 116.5ºC |
| Exact Mass | 351.91000 |
| PSA | 17.07000 |
| LogP | 4.70600 |
| Index of Refraction | 1.644 |
| InChIKey | OJXOSDREVZTZEF-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1cccc(C(Br)Br)c1 |
|
~83%
[3-(dibromometh... CAS#:72235-46-2 |
| Literature: Mataka, Shuntaro; Liu, Guo-Bin; Tori-I, Akiyoshi; Tashiro, Masashi Bulletin of the Chemical Society of Japan, 1994 , vol. 67, # 8 p. 2336 - 2338 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |