neolinustatin structure
|
Common Name | neolinustatin | ||
|---|---|---|---|---|
| CAS Number | 72229-42-6 | Molecular Weight | 423.41 | |
| Density | 1.52g/cm3 | Boiling Point | 705.6ºC at 760 mmHg | |
| Molecular Formula | C17H29NO11 | Melting Point | 190-192 °C | |
| MSDS | N/A | Flash Point | 380.5ºC | |
Use of neolinustatinNeolinustatin is a cyanogenic glycoside that can be isolated from flaxseeds[1]. |
| Name | neolinustatin |
|---|
| Description | Neolinustatin is a cyanogenic glycoside that can be isolated from flaxseeds[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 705.6ºC at 760 mmHg |
| Melting Point | 190-192 °C |
| Molecular Formula | C17H29NO11 |
| Molecular Weight | 423.41 |
| Flash Point | 380.5ºC |
| Exact Mass | 423.17400 |
| PSA | 202.32000 |
| Index of Refraction | 1.594 |
| InChIKey | WOSYVGNDRYBQCQ-BARGLTKPSA-N |
| SMILES | CCC(C)(C#N)OC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O |