2-(4-Chlorophenyl)thiazole-5-carbaldehyde structure
|
Common Name | 2-(4-Chlorophenyl)thiazole-5-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 721920-84-9 | Molecular Weight | 223.67900 | |
| Density | 1.389g/cm3 | Boiling Point | 377.571ºC at 760 mmHg | |
| Molecular Formula | C10H6ClNOS | Melting Point | N/A | |
| MSDS | USA | Flash Point | 182.149ºC | |
| Name | 2-(4-Chlorophenyl)thiazole-5-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 377.571ºC at 760 mmHg |
| Molecular Formula | C10H6ClNOS |
| Molecular Weight | 223.67900 |
| Flash Point | 182.149ºC |
| Exact Mass | 222.98600 |
| PSA | 58.20000 |
| LogP | 3.27600 |
| Index of Refraction | 1.653 |
| InChIKey | QJHQBOBUAOFVLH-UHFFFAOYSA-N |
| SMILES | O=Cc1cnc(-c2ccc(Cl)cc2)s1 |
| HS Code | 2934100090 |
|---|
|
~91%
2-(4-Chlorophen... CAS#:721920-84-9 |
| Literature: PHARMACIA CORPORATION Patent: WO2004/58761 A1, 2004 ; Location in patent: Page 37-38 ; |
|
~%
2-(4-Chlorophen... CAS#:721920-84-9 |
| Literature: WO2010/80864 A1, ; Page/Page column 110-111 ; |
|
~%
2-(4-Chlorophen... CAS#:721920-84-9 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 20, # 24 p. 7216 - 7221 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-(4-chlorophenyl)-1,3-thiazole-5-carbaldehyde |