methyl 2-methyl-3-oxo-1H-indene-2-carboxylate structure
|
Common Name | methyl 2-methyl-3-oxo-1H-indene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 72181-95-4 | Molecular Weight | 204.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-methyl-3-oxo-1H-indene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12O3 |
|---|---|
| Molecular Weight | 204.22200 |
| Exact Mass | 204.07900 |
| PSA | 43.37000 |
| LogP | 1.60470 |
| InChIKey | PMJCDJNXOXOUKF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(C)Cc2ccccc2C1=O |
| HS Code | 2918300090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-methyl-3-oxo-1H-indene-2-carboxylic acid methyl ester |
| methyl 2-methyl-1-oxo-2-indanecarboxylate |
| methyl 2-methyl-1-oxoindanone-2-carboxylate |
| METHYL 2-METHYL-1-OXO-2,3-DIHYDRO-1H-INDENE-2-CARBOXYLATE |
| 2-Methyl-3-oxo-2,3-dihydro-1H-inden-2-carbonsaeuremethylester |
| 2-methyl-2-methoxycarbonyl-1-indanone |